![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | ATPase assay.tar.gz | 2022-12-27 21:56 | 32K | |
| Assay of oligogalacturonide uptake in E. coli.tar.gz | 2022-12-27 21:56 | 11K | |
| GlcNAc phosphorylation assays.tar.gz | 2022-12-27 21:56 | 16K | |
| NMR.tar.gz | 2022-12-27 21:56 | 1.2M | |
| Northern Blot.tar.gz | 2022-12-27 21:56 | 321K | |
| RNA-Seq.tar.gz | 2022-12-27 21:56 | 1.8M | |
| RT-PCR.tar.gz | 2022-12-27 21:56 | 2.2M | |
| RT-qPCR.tar.gz | 2022-12-27 21:56 | 348K | |
| SDS-PAGE.tar.gz | 2022-12-27 21:56 | 89K | |
| Smith degradation.tar.gz | 2022-12-27 21:56 | 40K | |
| Southern Blot.tar.gz | 2022-12-27 21:56 | 91K | |
| Western Blot.tar.gz | 2022-12-27 21:56 | 313K | |
| acid hydrolysis.tar.gz | 2022-12-27 21:56 | 10K | |
| adhesion assay.tar.gz | 2022-12-27 21:56 | 57K | |
| affinity gel electrophoresis.tar.gz | 2022-12-27 21:56 | 247K | |
| analysis of reaction products.tar.gz | 2022-12-27 21:56 | 577K | |
| beta-galactosidase assays.tar.gz | 2022-12-27 21:56 | 8.6K | |
| bicinchoninic acid (BCA) reducing-sugar assay.tar.gz | 2022-12-27 21:56 | 199K | |
| binding assay.tar.gz | 2022-12-27 21:56 | 898K | |
| carbohydrate binding assay.tar.gz | 2022-12-27 21:56 | 102K | |
| carbon utilization assay.tar.gz | 2022-12-27 21:56 | 8.8K | |
| clone and expression.tar.gz | 2022-12-27 21:56 | 140K | |
| comparative genomics.tar.gz | 2022-12-27 21:56 | 118K | |
| complementation study.tar.gz | 2022-12-27 21:56 | 22K | |
| cosmid library screening.tar.gz | 2022-12-27 21:56 | 4.3K | |
| crystallization.tar.gz | 2022-12-27 21:56 | 26K | |
| differential gene expression.tar.gz | 2022-12-27 21:56 | 323K | |
| electrophoretic mobility shift assay.tar.gz | 2022-12-27 21:56 | 266K | |
| enzymatic product analysis.tar.gz | 2022-12-27 21:56 | 24K | |
| enzyme activity assay.tar.gz | 2022-12-27 21:56 | 4.6M | |
| enzyme kinetic analysis.tar.gz | 2022-12-27 21:56 | 10K | |
| enzyme product analysis.tar.gz | 2022-12-27 21:56 | 199K | |
| enzyme specificity assay.tar.gz | 2022-12-27 21:56 | 84K | |
| expression of recombinant proteins.tar.gz | 2022-12-27 21:56 | 118K | |
| fitness contribution assay.tar.gz | 2022-12-27 21:56 | 14K | |
| fosmid library screen.tar.gz | 2022-12-27 21:56 | 1.5M | |
| functional enrichment analysis.tar.gz | 2022-12-27 21:56 | 114K | |
| gas chromatography and mass spectrometry.tar.gz | 2022-12-27 21:56 | 161K | |
| gene chips.tar.gz | 2022-12-27 21:56 | 280K | |
| gene deletion mutant and growth assay.tar.gz | 2022-12-27 21:56 | 1.1M | |
| genes induced in presence of substrate.tar.gz | 2022-12-27 21:56 | 8.4K | |
| gene trait matching exercise.tar.gz | 2022-12-27 21:56 | 163K | |
| growth assay.tar.gz | 2022-12-27 21:56 | 1.6M | |
| high performance anion exchange chromatography.tar.gz | 2022-12-27 21:56 | 444K | |
| immunoblotting.tar.gz | 2022-12-27 21:56 | 32K | |
| immunoprecipitation.tar.gz | 2022-12-27 21:56 | 14K | |
| insertion sequencing.tar.gz | 2022-12-27 21:56 | 14K | |
| ion trap liquid chromatography.tar.gz | 2022-12-27 21:56 | 72K | |
| isothermal calorimetric titration.tar.gz | 2022-12-27 21:56 | 99K | |
| isothermal titration calorimetry.tar.gz | 2022-12-27 21:56 | 566K | |
| label-free quantitative proteomics.tar.gz | 2022-12-27 21:56 | 114K | |
| lectin binding assay.tar.gz | 2022-12-27 21:56 | 582K | |
| liquid chromatography and mass spectrometry.tar.gz | 2022-12-27 21:56 | 363K | |
| mass spectrometry.tar.gz | 2022-12-27 21:56 | 1.3M | |
| microarray.tar.gz | 2022-12-27 21:56 | 2.2M | |
| microscopy.tar.gz | 2022-12-27 21:56 | 771K | |
| primer extension analysis.tar.gz | 2022-12-27 21:56 | 40K | |
| promoter assay.tar.gz | 2022-12-27 21:56 | 7.3K | |
| protein fingerprinting (MALDI-TOF PMF).tar.gz | 2022-12-27 21:56 | 34K | |
| proteome fractionation.tar.gz | 2022-12-27 21:56 | 85K | |
| qPCR.tar.gz | 2022-12-27 21:56 | 1.9M | |
| qRT-PCR.tar.gz | 2022-12-27 21:56 | 701K | |
| rapid plate method growth assay.tar.gz | 2022-12-27 21:56 | 78K | |
| recombinant protein expression.tar.gz | 2022-12-27 21:56 | 578K | |
| reducing-sugar assay.tar.gz | 2022-12-27 21:56 | 239K | |
| sequence homology analysis.tar.gz | 2022-12-27 21:56 | 3.3M | |
| substrate binding assay.tar.gz | 2022-12-27 21:56 | 164K | |
| substrate specificity assay.tar.gz | 2022-12-27 21:56 | 62K | |
| sugar utilization assay.tar.gz | 2022-12-27 21:56 | 1.0M | |
| target decoy database analysis.tar.gz | 2022-12-27 21:56 | 249K | |
| thin layer chromatography.tar.gz | 2022-12-27 21:56 | 731K | |
| transport assay.tar.gz | 2022-12-27 21:56 | 8.9K | |
| transposon mutagenesis.tar.gz | 2022-12-27 21:56 | 61K | |
| yeast two hybrid assay.tar.gz | 2022-12-27 21:56 | 9.4K | |
|
|---|